C10H16F2NO6S- — CID 59503223
2-[2-(2,2-dimethylbutanoyloxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 59503223) has the molecular formula C10H16F2NO6S- and a molecular weight of 316.30 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoyloxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[2-(2,2-dimethylbutanoyloxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 59503223 |
| Molecular Formula | C10H16F2NO6S- |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoyloxy)ethylamino]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H17F2NO6S/c1-4-9(2,3)8(15)19-6-5-13-7(14)10(11,12)20(16,17)18/h4-6H2,1-3H3,(H,13,14)(H,16,17,18)/p-1 |
| InChIKey | WCKFMAODIASHQH-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|