C19H37NO4 — CID 160743498
2-[(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxycarbonylamino]ethyl 2,2-dimethylbutanoate (PubChem CID 160743498) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxycarbonylamino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxycarbonylamino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160743498 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 2-[(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxycarbonylamino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OC(C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H37NO4/c1-10-18(8,9)16(21)23-12-11-20-17(22)24-19(13(2)3,14(4)5)15(6)7/h13-15H,10-12H2,1-9H3,(H,20,22) |
| InChIKey | QFYFCLOJAKKBQH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|