C18H31NO8 — CID 121418780
2-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 121418780) has the molecular formula C18H31NO8 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 2-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 121418780 |
| Molecular Formula | C18H31NO8 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[3-(2,2-dimethylbutanoyloxy)propanoyloxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCC(C)(C)C(=O)OCCC(=O)OC(CCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H31NO8/c1-7-18(5,6)15(23)25-11-9-13(20)26-12(14(21)22)8-10-19-16(24)27-17(2,3)4/h12H,7-11H2,1-6H3,(H,19,24)(H,21,22) |
| InChIKey | HAVIUUPYHMKUNY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|