C15H30N2O5 — CID 59367237
tert-butyl N-[3-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate (PubChem CID 59367237) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 59367237 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | tert-butyl N-[3-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O5/c1-14(2,3)21-12(19)16-9-7-11(18)8-10-17-13(20)22-15(4,5)6/h11,18H,7-10H2,1-6H3,(H,16,19)(H,17,20) |
| InChIKey | INZCCGFGEHTXMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |