C13H28N2O2 — CID 89229854
tert-butyl N-[3-ethyl-5-(methylamino)pentyl]carbamate (PubChem CID 89229854) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl N-[3-ethyl-5-(methylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[3-ethyl-5-(methylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 89229854 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl N-[3-ethyl-5-(methylamino)pentyl]carbamate |
| SMILES | CCC(CCNC)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-6-11(7-9-14-5)8-10-15-12(16)17-13(2,3)4/h11,14H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | DEDUDLRWFDBKSD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |