C13H27NO5S — CID 163576586
[3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate (PubChem CID 163576586) has the molecular formula C13H27NO5S and a molecular weight of 309.43 g/mol. Its IUPAC name is [3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate.
| Compound Name | [3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate |
|---|---|
| PubChem CID | 163576586 |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [3-ethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] methanesulfonate |
| SMILES | CCC(CCNC(=O)OC(C)(C)C)CCOS(C)(=O)=O |
| InChI | InChI=1S/C13H27NO5S/c1-6-11(8-10-18-20(5,16)17)7-9-14-12(15)19-13(2,3)4/h11H,6-10H2,1-5H3,(H,14,15) |
| InChIKey | GDZZBAHUAWUIJZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|