C14H25NO6 — CID 177138583
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]heptanedioic acid (PubChem CID 177138583) has the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]heptanedioic acid.
| Compound Name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]heptanedioic acid |
|---|---|
| PubChem CID | 177138583 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]heptanedioic acid |
| SMILES | CC(C)(C)OC(=O)NCCC(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C14H25NO6/c1-14(2,3)21-13(20)15-9-8-10(4-6-11(16)17)5-7-12(18)19/h10H,4-9H2,1-3H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | UCELGUJQQGMXBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |