C15H30N2O7S — CID 172568836
4,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butyl methanesulfonate (PubChem CID 172568836) has the molecular formula C15H30N2O7S and a molecular weight of 382.48 g/mol. Its IUPAC name is 4,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butyl methanesulfonate.
| Compound Name | 4,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butyl methanesulfonate |
|---|---|
| PubChem CID | 172568836 |
| Molecular Formula | C15H30N2O7S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(CCCOS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O7S/c1-14(2,3)23-12(18)16-11(9-8-10-22-25(7,20)21)17-13(19)24-15(4,5)6/h11H,8-10H2,1-7H3,(H,16,18)(H,17,19) |
| InChIKey | XPQVEYTUOUHOBX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|