C9H19NO5S — CID 10753379
[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 10753379) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 10753379 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | C[C@@H](COS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19NO5S/c1-7(6-14-16(5,12)13)10-8(11)15-9(2,3)4/h7H,6H2,1-5H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | NLKBUJQLMRHSKP-ZETCQYMHSA-N |
| XLogP | 0.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|