C10H21NO4 — CID 177407603
tert-butyl N-[(2S)-1-(methoxymethoxy)propan-2-yl]carbamate (PubChem CID 177407603) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(methoxymethoxy)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(methoxymethoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 177407603 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-(methoxymethoxy)propan-2-yl]carbamate |
| SMILES | COCOC[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO4/c1-8(6-14-7-13-5)11-9(12)15-10(2,3)4/h8H,6-7H2,1-5H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | ZSVQDQLHULJTBM-QMMMGPOBSA-N |
| XLogP | 1.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|