C12H25NO2 — CID 59686952
tert-butyl N-(4,4-dimethylpentan-2-yl)carbamate (PubChem CID 59686952) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is tert-butyl N-(4,4-dimethylpentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(4,4-dimethylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 59686952 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | tert-butyl N-(4,4-dimethylpentan-2-yl)carbamate |
| SMILES | CC(CC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-9(8-11(2,3)4)13-10(14)15-12(5,6)7/h9H,8H2,1-7H3,(H,13,14) |
| InChIKey | IKUBRBJLKRGJFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |