C16H31NO3 — CID 90394148
tert-butyl N-(2,2,6,6-tetramethyl-3-oxoheptan-4-yl)carbamate (PubChem CID 90394148) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-(2,2,6,6-tetramethyl-3-oxoheptan-4-yl)carbamate.
| Compound Name | tert-butyl N-(2,2,6,6-tetramethyl-3-oxoheptan-4-yl)carbamate |
|---|---|
| PubChem CID | 90394148 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-(2,2,6,6-tetramethyl-3-oxoheptan-4-yl)carbamate |
| SMILES | CC(C)(C)CC(NC(=O)OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-14(2,3)10-11(12(18)15(4,5)6)17-13(19)20-16(7,8)9/h11H,10H2,1-9H3,(H,17,19) |
| InChIKey | NJJYZKNZHJYQRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |