C12H22N2O2 — CID 129050700
tert-butyl N-[(1S)-1-cyano-3,3-dimethylbutyl]carbamate (PubChem CID 129050700) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cyano-3,3-dimethylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-cyano-3,3-dimethylbutyl]carbamate |
|---|---|
| PubChem CID | 129050700 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-cyano-3,3-dimethylbutyl]carbamate |
| SMILES | CC(C)(C)C[C@@H](C#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-11(2,3)7-9(8-13)14-10(15)16-12(4,5)6/h9H,7H2,1-6H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | VJKQHLNPMKTETG-VIFPVBQESA-N |
| XLogP | 2.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |