C9H16N2O3 — CID 545704
tert-butyl N-(1-cyano-1-hydroxypropan-2-yl)carbamate (PubChem CID 545704) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-1-hydroxypropan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-cyano-1-hydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 545704 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | tert-butyl N-(1-cyano-1-hydroxypropan-2-yl)carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(O)C#N |
| InChI | InChI=1S/C9H16N2O3/c1-6(7(12)5-10)11-8(13)14-9(2,3)4/h6-7,12H,1-4H3,(H,11,13) |
| InChIKey | UQQLQRJZABVGGR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|