C12H25NO2 — CID 174039144
tert-butyl N-[(2R,3S)-3,4-dimethylpentan-2-yl]carbamate (PubChem CID 174039144) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3,4-dimethylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3,4-dimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 174039144 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3,4-dimethylpentan-2-yl]carbamate |
| SMILES | CC(C)[C@H](C)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-8(2)9(3)10(4)13-11(14)15-12(5,6)7/h8-10H,1-7H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | SMDRZCHKKCEEAB-VHSXEESVSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |