C8H15ClN2O3 — CID 91562701
tert-butyl N-[(2R)-1-chloro-1-nitrosopropan-2-yl]carbamate (PubChem CID 91562701) has the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-chloro-1-nitrosopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-chloro-1-nitrosopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91562701 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | tert-butyl N-[(2R)-1-chloro-1-nitrosopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(Cl)N=O |
| InChI | InChI=1S/C8H15ClN2O3/c1-5(6(9)11-13)10-7(12)14-8(2,3)4/h5-6H,1-4H3,(H,10,12)/t5-,6?/m1/s1 |
| InChIKey | WOKMOJHNKDFHLL-LWOQYNTDSA-N |
| XLogP | 2.23 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|