C10H18NO4- — CID 71435357
2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 71435357) has the molecular formula C10H18NO4- and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 71435357 |
| Molecular Formula | C10H18NO4- |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(C)C(=O)[O-] |
| InChI | InChI=1S/C10H19NO4/c1-6(8(12)13)7(2)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/p-1 |
| InChIKey | VZHAMECIWIQGRU-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |