C9H16LiNO5 — CID 162520562
lithium 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 162520562) has the molecular formula C9H16LiNO5 and a molecular weight of 225.17 g/mol. Its IUPAC name is lithium 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | lithium 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 162520562 |
| Molecular Formula | C9H16LiNO5 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | lithium 2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(O)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C9H17NO5.Li/c1-5(6(11)7(12)13)10-8(14)15-9(2,3)4;/h5-6,11H,1-4H3,(H,10,14)(H,12,13);/q;+1/p-1 |
| InChIKey | RJRLWWBIWUFXOT-UHFFFAOYSA-M |
| XLogP | -3.99 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |