C10H19NO4 — CID 87381369
(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 87381369) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 87381369 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(NC(=O)OC(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-6(8(12)13)7(2)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t6-,7?/m1/s1 |
| InChIKey | VZHAMECIWIQGRU-ULUSZKPHSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |