C11H20BrNO3 — CID 104701941
tert-butyl N-(5-bromo-3-methyl-4-oxopentan-2-yl)carbamate (PubChem CID 104701941) has the molecular formula C11H20BrNO3 and a molecular weight of 294.19 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-3-methyl-4-oxopentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-3-methyl-4-oxopentan-2-yl)carbamate |
|---|---|
| PubChem CID | 104701941 |
| Molecular Formula | C11H20BrNO3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | tert-butyl N-(5-bromo-3-methyl-4-oxopentan-2-yl)carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(C)C(=O)CBr |
| InChI | InChI=1S/C11H20BrNO3/c1-7(9(14)6-12)8(2)13-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,13,15) |
| InChIKey | ZHHWOXNTRGLNBE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|