C9H15BrN2O4 — CID 88696472
tert-butyl N-(1-amino-4-bromo-1,3-dioxobutan-2-yl)carbamate (PubChem CID 88696472) has the molecular formula C9H15BrN2O4 and a molecular weight of 295.13 g/mol. Its IUPAC name is tert-butyl N-(1-amino-4-bromo-1,3-dioxobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-4-bromo-1,3-dioxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 88696472 |
| Molecular Formula | C9H15BrN2O4 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | tert-butyl N-(1-amino-4-bromo-1,3-dioxobutan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(N)=O)C(=O)CBr |
| InChI | InChI=1S/C9H15BrN2O4/c1-9(2,3)16-8(15)12-6(7(11)14)5(13)4-10/h6H,4H2,1-3H3,(H2,11,14)(H,12,15) |
| InChIKey | GUWVZQIOYDFKEP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|