C17H34N2O3 — CID 10805236
tert-butyl N-[(4S)-6-carbamoyl-2,8-dimethylnonan-4-yl]carbamate (PubChem CID 10805236) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl N-[(4S)-6-carbamoyl-2,8-dimethylnonan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-6-carbamoyl-2,8-dimethylnonan-4-yl]carbamate |
|---|---|
| PubChem CID | 10805236 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl N-[(4S)-6-carbamoyl-2,8-dimethylnonan-4-yl]carbamate |
| SMILES | CC(C)CC(C[C@H](CC(C)C)NC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C17H34N2O3/c1-11(2)8-13(15(18)20)10-14(9-12(3)4)19-16(21)22-17(5,6)7/h11-14H,8-10H2,1-7H3,(H2,18,20)(H,19,21)/t13?,14-/m0/s1 |
| InChIKey | LMZFBIKNWWKAAG-KZUDCZAMSA-N |
| XLogP | 3.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |