C15H28BrNO4 — CID 86641000
[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-bromobutanoate (PubChem CID 86641000) has the molecular formula C15H28BrNO4 and a molecular weight of 366.30 g/mol. Its IUPAC name is [4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-bromobutanoate.
| Compound Name | [4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-bromobutanoate |
|---|---|
| PubChem CID | 86641000 |
| Molecular Formula | C15H28BrNO4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-bromobutanoate |
| SMILES | CC(C)CC(COC(=O)CCCBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28BrNO4/c1-11(2)9-12(10-20-13(18)7-6-8-16)17-14(19)21-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | YZEREGWHDJWKEO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|