C15H28BrNO4 — CID 135013903
methyl (3R)-9-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate (PubChem CID 135013903) has the molecular formula C15H28BrNO4 and a molecular weight of 366.30 g/mol. Its IUPAC name is methyl (3R)-9-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate.
| Compound Name | methyl (3R)-9-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
|---|---|
| PubChem CID | 135013903 |
| Molecular Formula | C15H28BrNO4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl (3R)-9-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
| SMILES | COC(=O)C[C@@H](CCCCCCBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28BrNO4/c1-15(2,3)21-14(19)17-12(11-13(18)20-4)9-7-5-6-8-10-16/h12H,5-11H2,1-4H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | ZNOHLIVLJPPVLR-GFCCVEGCSA-N |
| XLogP | 3.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|