About 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate
3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate (PubChem CID 129387790) has the molecular formula C15H27BrO4
and a molecular weight of 351.28 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate |
| PubChem CID | 129387790 |
| Molecular Formula | C15H27BrO4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate |
| SMILES | COC(=O)[C@H](CCCCCCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27BrO4/c1-15(2,3)20-14(18)12(13(17)19-4)10-8-6-5-7-9-11-16/h12H,5-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | FOTZBRYGOFYCQA-LBPRGKRZSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate (CID 129387790) is 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate is COC(=O)[C@H](CCCCCCCBr)C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate?
The InChIKey is FOTZBRYGOFYCQA-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H27BrO4/c1-15(2,3)20-14(18)12(13(17)19-4)10-8-6-5-7-9-11-16/h12H,5-11H2,1-4H3/t12-/m0/s1.
What are the key properties of 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate?
3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate has a molecular weight of 351.28 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl (2S)-2-(7-bromoheptyl)propanedioate is sourced from PubChem (CID 129387790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).