C11H21NO5 — CID 174531674
3-O-tert-butyl 1-O-methyl 2-(3-amino-3-hydroxypropyl)propanedioate (PubChem CID 174531674) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-(3-amino-3-hydroxypropyl)propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-(3-amino-3-hydroxypropyl)propanedioate |
|---|---|
| PubChem CID | 174531674 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-(3-amino-3-hydroxypropyl)propanedioate |
| SMILES | COC(=O)C(CCC(N)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO5/c1-11(2,3)17-10(15)7(9(14)16-4)5-6-8(12)13/h7-8,13H,5-6,12H2,1-4H3 |
| InChIKey | HMGOAHSKXFUCFR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|