C17H29NO8 — CID 11440260
1-O-tert-butyl 1-O,3-O-dimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate (PubChem CID 11440260) has the molecular formula C17H29NO8 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-O-tert-butyl 1-O,3-O-dimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate.
| Compound Name | 1-O-tert-butyl 1-O,3-O-dimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 11440260 |
| Molecular Formula | C17H29NO8 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-O-tert-butyl 1-O,3-O-dimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate |
| SMILES | COC(=O)C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO8/c1-16(2,3)25-13(20)10(12(19)23-7)9-11(14(21)24-8)18-15(22)26-17(4,5)6/h10-11H,9H2,1-8H3,(H,18,22)/t10?,11-/m0/s1 |
| InChIKey | LBIGDMSPZRCSGK-DTIOYNMSSA-N |
| XLogP | 1.57 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|