C18H33NO7 — CID 102004003
ditert-butyl (2S,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 102004003) has the molecular formula C18H33NO7 and a molecular weight of 375.46 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 102004003 |
| Molecular Formula | C18H33NO7 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | ditert-butyl (2S,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H](O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO7/c1-16(2,3)24-13(21)11(19-15(23)26-18(7,8)9)10-12(20)14(22)25-17(4,5)6/h11-12,20H,10H2,1-9H3,(H,19,23)/t11-,12-/m0/s1 |
| InChIKey | MZZAEIAAOFQOTM-RYUDHWBXSA-N |
| XLogP | 2.31 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|