C13H22FNO5 — CID 101008019
tert-butyl (2S)-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 101008019) has the molecular formula C13H22FNO5 and a molecular weight of 291.32 g/mol. Its IUPAC name is tert-butyl (2S)-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | tert-butyl (2S)-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 101008019 |
| Molecular Formula | C13H22FNO5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl (2S)-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22FNO5/c1-12(2,3)19-10(17)8(7-9(14)16)15-11(18)20-13(4,5)6/h8H,7H2,1-6H3,(H,15,18)/t8-/m0/s1 |
| InChIKey | URZJJGMOVQDLAG-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|