C17H28O8 — CID 141234633
3-O,3-O-ditert-butyl 1-O,1-O-dimethyl propane-1,1,3,3-tetracarboxylate (PubChem CID 141234633) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is 3-O,3-O-ditert-butyl 1-O,1-O-dimethyl propane-1,1,3,3-tetracarboxylate.
| Compound Name | 3-O,3-O-ditert-butyl 1-O,1-O-dimethyl propane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 141234633 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-O,3-O-ditert-butyl 1-O,1-O-dimethyl propane-1,1,3,3-tetracarboxylate |
| SMILES | COC(=O)C(CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C17H28O8/c1-16(2,3)24-14(20)11(15(21)25-17(4,5)6)9-10(12(18)22-7)13(19)23-8/h10-11H,9H2,1-8H3 |
| InChIKey | WTSXAIZZPOTGTA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|