About 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate
3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate (PubChem CID 91757639) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate |
| PubChem CID | 91757639 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate |
| SMILES | COC(=O)[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H16O4/c1-6(7(10)12-5)8(11)13-9(2,3)4/h6H,1-5H3/t6-/m0/s1 |
| InChIKey | JDQGMPGKDBIWOI-LURJTMIESA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate (CID 91757639) is 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate is COC(=O)[C@H](C)C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate?
The InChIKey is JDQGMPGKDBIWOI-LURJTMIESA-N. The full InChI is InChI=1S/C9H16O4/c1-6(7(10)12-5)8(11)13-9(2,3)4/h6H,1-5H3/t6-/m0/s1.
What are the key properties of 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate?
3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate has a molecular weight of 188.22 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl (2S)-2-methylpropanedioate is sourced from PubChem (CID 91757639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).