C15H32O4Si2 — CID 10640362
4-O-tert-butyl 1-O-methyl (2S,3R)-2,3-bis(trimethylsilyl)butanedioate (PubChem CID 10640362) has the molecular formula C15H32O4Si2 and a molecular weight of 332.59 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S,3R)-2,3-bis(trimethylsilyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S,3R)-2,3-bis(trimethylsilyl)butanedioate |
|---|---|
| PubChem CID | 10640362 |
| Molecular Formula | C15H32O4Si2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S,3R)-2,3-bis(trimethylsilyl)butanedioate |
| SMILES | COC(=O)[C@@H]([C@@H](C(=O)OC(C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H32O4Si2/c1-15(2,3)19-14(17)12(21(8,9)10)11(13(16)18-4)20(5,6)7/h11-12H,1-10H3/t11-,12+/m1/s1 |
| InChIKey | RNYQVFANEAUEDP-NEPJUHHUSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|