C16H28N2O8 — CID 10474650
dimethyl (2S,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 10474650) has the molecular formula C16H28N2O8 and a molecular weight of 376.41 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | dimethyl (2S,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 10474650 |
| Molecular Formula | C16H28N2O8 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | dimethyl (2S,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C16H28N2O8/c1-15(2,3)25-13(21)17-9(11(19)23-7)10(12(20)24-8)18-14(22)26-16(4,5)6/h9-10H,1-8H3,(H,17,21)(H,18,22)/t9-,10+ |
| InChIKey | XMHPFGREFFVISP-AOOOYVTPSA-N |
| XLogP | 1.12 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|