C8H17N3O4 — CID 154966120
(2S)-3,3-diamino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 154966120) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2S)-3,3-diamino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3,3-diamino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 154966120 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2S)-3,3-diamino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(N)N |
| InChI | InChI=1S/C8H17N3O4/c1-8(2,3)15-7(14)11-4(5(9)10)6(12)13/h4-5H,9-10H2,1-3H3,(H,11,14)(H,12,13)/t4-/m0/s1 |
| InChIKey | DSRCWNQSJNRMNU-BYPYZUCNSA-N |
| XLogP | -0.79 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|