C10H20N2O5 — CID 11322610
3-(methoxyamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 11322610) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(methoxyamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 3-(methoxyamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 11322610 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-(methoxyamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CONC(C)C(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-6(12-16-5)7(8(13)14)11-9(15)17-10(2,3)4/h6-7,12H,1-5H3,(H,11,15)(H,13,14) |
| InChIKey | MNDCQMKTVNYHDH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|