C9H18N2O7S — CID 175038893
(2R,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(sulfinooxyamino)butanoic acid (PubChem CID 175038893) has the molecular formula C9H18N2O7S and a molecular weight of 298.32 g/mol. Its IUPAC name is (2R,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(sulfinooxyamino)butanoic acid.
| Compound Name | (2R,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(sulfinooxyamino)butanoic acid |
|---|---|
| PubChem CID | 175038893 |
| Molecular Formula | C9H18N2O7S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2R,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(sulfinooxyamino)butanoic acid |
| SMILES | C[C@@H](NOS(=O)O)[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H18N2O7S/c1-5(11-18-19(15)16)6(7(12)13)10-8(14)17-9(2,3)4/h5-6,11H,1-4H3,(H,10,14)(H,12,13)(H,15,16)/t5-,6-/m1/s1 |
| InChIKey | QFISFZLQYYVBBA-PHDIDXHHSA-N |
| XLogP | 0.01 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|