C16H29FN2O6 — CID 75152414
methyl 3-fluoro-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 75152414) has the molecular formula C16H29FN2O6 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 3-fluoro-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl 3-fluoro-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 75152414 |
| Molecular Formula | C16H29FN2O6 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 3-fluoro-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(F)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29FN2O6/c1-15(2,3)24-13(21)18-9-8-10(17)11(12(20)23-7)19-14(22)25-16(4,5)6/h10-11H,8-9H2,1-7H3,(H,18,21)(H,19,22) |
| InChIKey | PRSBKDOAAIEKQK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|