C11H18FNO4 — CID 102278748
methyl (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 102278748) has the molecular formula C11H18FNO4 and a molecular weight of 247.27 g/mol. Its IUPAC name is methyl (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | methyl (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 102278748 |
| Molecular Formula | C11H18FNO4 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CC(F)[C@@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C11H18FNO4/c1-6-7(12)8(9(14)16-5)13-10(15)17-11(2,3)4/h6-8H,1H2,2-5H3,(H,13,15)/t7?,8-/m1/s1 |
| InChIKey | IUAZAKQSXPZCAZ-BRFYHDHCSA-N |
| XLogP | 1.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|