C10H18INO4 — CID 14394149
methyl 4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 14394149) has the molecular formula C10H18INO4 and a molecular weight of 343.16 g/mol. Its IUPAC name is methyl 4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 14394149 |
| Molecular Formula | C10H18INO4 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | methyl 4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(CCI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18INO4/c1-10(2,3)16-9(14)12-7(5-6-11)8(13)15-4/h7H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | VYAWQKJZQJHWPR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|