C17H32N2O7 — CID 101344037
methyl (2S,5S)-5-hydroxy-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 101344037) has the molecular formula C17H32N2O7 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl (2S,5S)-5-hydroxy-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S,5S)-5-hydroxy-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 101344037 |
| Molecular Formula | C17H32N2O7 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (2S,5S)-5-hydroxy-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CC[C@H](O)CNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O7/c1-16(2,3)25-14(22)18-10-11(20)8-9-12(13(21)24-7)19-15(23)26-17(4,5)6/h11-12,20H,8-10H2,1-7H3,(H,18,22)(H,19,23)/t11-,12-/m0/s1 |
| InChIKey | VROJHMIETVWHIE-RYUDHWBXSA-N |
| XLogP | 1.72 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|