C15H27NO5 — CID 24813413
methyl (2R,5R)-5-hydroxy-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoate (PubChem CID 24813413) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is methyl (2R,5R)-5-hydroxy-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoate.
| Compound Name | methyl (2R,5R)-5-hydroxy-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoate |
|---|---|
| PubChem CID | 24813413 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | methyl (2R,5R)-5-hydroxy-7-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oct-6-enoate |
| SMILES | COC(=O)[C@@H](CC[C@@H](O)C=C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO5/c1-10(2)9-11(17)7-8-12(13(18)20-6)16-14(19)21-15(3,4)5/h9,11-12,17H,7-8H2,1-6H3,(H,16,19)/t11-,12-/m1/s1 |
| InChIKey | FXQMYYOUZZTLNX-VXGBXAGGSA-N |
| XLogP | 2.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|