C14H25NO6S — CID 178106028
methyl (2R)-6-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate (PubChem CID 178106028) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is methyl (2R)-6-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate.
| Compound Name | methyl (2R)-6-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate |
|---|---|
| PubChem CID | 178106028 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl (2R)-6-[dimethyl(oxo)-λ6-sulfanylidene]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxohexanoate |
| SMILES | COC(=O)[C@@H](CCC(=O)C=S(C)(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO6S/c1-14(2,3)21-13(18)15-11(12(17)20-4)8-7-10(16)9-22(5,6)19/h9,11H,7-8H2,1-6H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | XERUTVTVZHKNOX-LLVKDONJSA-N |
| XLogP | 0.75 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|