C15H31NO4S — CID 145375423
tert-butyl N-[(3R)-7-[dimethyl(oxo)-λ6-sulfanylidene]-2-methyl-6-oxoheptan-3-yl]carbamate;molecular hydrogen (PubChem CID 145375423) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-[dimethyl(oxo)-λ6-sulfanylidene]-2-methyl-6-oxoheptan-3-yl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[(3R)-7-[dimethyl(oxo)-λ6-sulfanylidene]-2-methyl-6-oxoheptan-3-yl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 145375423 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | tert-butyl N-[(3R)-7-[dimethyl(oxo)-λ6-sulfanylidene]-2-methyl-6-oxoheptan-3-yl]carbamate;molecular hydrogen |
| SMILES | CC(C)[C@@H](CCC(=O)C=S(C)(C)=O)NC(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C15H29NO4S.H2/c1-11(2)13(16-14(18)20-15(3,4)5)9-8-12(17)10-21(6,7)19;/h10-11,13H,8-9H2,1-7H3,(H,16,18);1H/t13-;/m1./s1 |
| InChIKey | CKEIOJONGVLPLS-BTQNPOSSSA-N |
| XLogP | 2.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|