C13H29N3O2 — CID 130381371
tert-butyl N-[(6S)-6,7-diamino-2-methylheptan-3-yl]carbamate (PubChem CID 130381371) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is tert-butyl N-[(6S)-6,7-diamino-2-methylheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(6S)-6,7-diamino-2-methylheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 130381371 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | tert-butyl N-[(6S)-6,7-diamino-2-methylheptan-3-yl]carbamate |
| SMILES | CC(C)C(CC[C@H](N)CN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H29N3O2/c1-9(2)11(7-6-10(15)8-14)16-12(17)18-13(3,4)5/h9-11H,6-8,14-15H2,1-5H3,(H,16,17)/t10-,11?/m0/s1 |
| InChIKey | HCQIYSVDJCHANK-VUWPPUDQSA-N |
| XLogP | 1.60 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |