C11H25N3O2 — CID 10704705
tert-butyl N-[(5S)-5,6-diaminohexyl]carbamate (PubChem CID 10704705) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5,6-diaminohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5,6-diaminohexyl]carbamate |
|---|---|
| PubChem CID | 10704705 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | tert-butyl N-[(5S)-5,6-diaminohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)CN |
| InChI | InChI=1S/C11H25N3O2/c1-11(2,3)16-10(15)14-7-5-4-6-9(13)8-12/h9H,4-8,12-13H2,1-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | QYOJETPEEKPPLJ-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|