C13H28N2O4 — CID 143611602
2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;ethane (PubChem CID 143611602) has the molecular formula C13H28N2O4 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;ethane.
| Compound Name | 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;ethane |
|---|---|
| PubChem CID | 143611602 |
| Molecular Formula | C13H28N2O4 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H22N2O4.C2H6/c1-11(2,3)17-10(16)13-7-5-4-6-8(12)9(14)15;1-2/h8H,4-7,12H2,1-3H3,(H,13,16)(H,14,15);1-2H3 |
| InChIKey | XIEMFYUAHATMPX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|