C18H36CuN4O8 — CID 4305518
bis(2-amino-6-(ethoxycarbonylamino)hexanoic acid);copper (PubChem CID 4305518) has the molecular formula C18H36CuN4O8 and a molecular weight of 500.05 g/mol. Its IUPAC name is bis(2-amino-6-(ethoxycarbonylamino)hexanoic acid);copper.
| Compound Name | bis(2-amino-6-(ethoxycarbonylamino)hexanoic acid);copper |
|---|---|
| PubChem CID | 4305518 |
| Molecular Formula | C18H36CuN4O8 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | bis(2-amino-6-(ethoxycarbonylamino)hexanoic acid);copper |
| SMILES | CCOC(=O)NCCCCC(N)C(=O)O.CCOC(=O)NCCCCC(N)C(=O)O.[Cu] |
| InChI | InChI=1S/2C9H18N2O4.Cu/c2*1-2-15-9(14)11-6-4-3-5-7(10)8(12)13;/h2*7H,2-6,10H2,1H3,(H,11,14)(H,12,13); |
| InChIKey | YBUNDKBQNQCRHC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 203.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|