C12H26N2O4Si — CID 87631740
2-amino-6-(2-trimethylsilylethoxycarbonylamino)hexanoic acid (PubChem CID 87631740) has the molecular formula C12H26N2O4Si and a molecular weight of 290.44 g/mol. Its IUPAC name is 2-amino-6-(2-trimethylsilylethoxycarbonylamino)hexanoic acid.
| Compound Name | 2-amino-6-(2-trimethylsilylethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 87631740 |
| Molecular Formula | C12H26N2O4Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-amino-6-(2-trimethylsilylethoxycarbonylamino)hexanoic acid |
| SMILES | C[Si](C)(C)CCOC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C12H26N2O4Si/c1-19(2,3)9-8-18-12(17)14-7-5-4-6-10(13)11(15)16/h10H,4-9,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | YVYXROIXKSKHQJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|