C11H18N6O4 — CID 90111541
(2S)-2-amino-6-[2-(1,2,4,5-tetrazin-3-yl)ethoxycarbonylamino]hexanoic acid (PubChem CID 90111541) has the molecular formula C11H18N6O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S)-2-amino-6-[2-(1,2,4,5-tetrazin-3-yl)ethoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[2-(1,2,4,5-tetrazin-3-yl)ethoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 90111541 |
| Molecular Formula | C11H18N6O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S)-2-amino-6-[2-(1,2,4,5-tetrazin-3-yl)ethoxycarbonylamino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)OCCc1nncnn1)C(=O)O |
| InChI | InChI=1S/C11H18N6O4/c12-8(10(18)19)3-1-2-5-13-11(20)21-6-4-9-16-14-7-15-17-9/h7-8H,1-6,12H2,(H,13,20)(H,18,19)/t8-/m0/s1 |
| InChIKey | GSCGZKFTCMKKHO-QMMMGPOBSA-N |
| XLogP | -0.88 |
| TPSA | 153.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|