C15H20N2O5 — CID 126611502
(2S)-2-amino-6-[(4-formylphenyl)methoxycarbonylamino]hexanoic acid (PubChem CID 126611502) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2S)-2-amino-6-[(4-formylphenyl)methoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(4-formylphenyl)methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 126611502 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2S)-2-amino-6-[(4-formylphenyl)methoxycarbonylamino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccc(C=O)cc1)C(=O)O |
| InChI | InChI=1S/C15H20N2O5/c16-13(14(19)20)3-1-2-8-17-15(21)22-10-12-6-4-11(9-18)5-7-12/h4-7,9,13H,1-3,8,10,16H2,(H,17,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | LSZKMKAKQNAXRY-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|